C21H26BrClO2 — CID 70305699
(E)-3-(4-bromo-5-chloro-2-methylphenyl)-4-hydroxy-4-(5-methyl-1,2,3,3a,4,6,7,7a-octahydroinden-5-yl)but-3-en-2-one (PubChem CID 70305699) has the molecular formula C21H26BrClO2 and a molecular weight of 425.79 g/mol. Its IUPAC name is (E)-3-(4-bromo-5-chloro-2-methylphenyl)-4-hydroxy-4-(5-methyl-1,2,3,3a,4,6,7,7a-octahydroinden-5-yl)but-3-en-2-one.
| Compound Name | (E)-3-(4-bromo-5-chloro-2-methylphenyl)-4-hydroxy-4-(5-methyl-1,2,3,3a,4,6,7,7a-octahydroinden-5-yl)but-3-en-2-one |
|---|---|
| PubChem CID | 70305699 |
| Molecular Formula | C21H26BrClO2 |
| Molecular Weight | 425.79 g/mol |
| Exact Mass | 424.08 |
| IUPAC Name | (E)-3-(4-bromo-5-chloro-2-methylphenyl)-4-hydroxy-4-(5-methyl-1,2,3,3a,4,6,7,7a-octahydroinden-5-yl)but-3-en-2-one |
| SMILES | CC(=O)/C(=C(/O)C1(C)CCC2CCCC2C1)c1cc(Cl)c(Br)cc1C |
| InChI | InChI=1S/C21H26BrClO2/c1-12-9-17(22)18(23)10-16(12)19(13(2)24)20(25)21(3)8-7-14-5-4-6-15(14)11-21/h9-10,14-15,25H,4-8,11H2,1-3H3/b20-19- |
| InChIKey | SBCAWGMGEUWHRG-VXPUYCOJSA-N |
| XLogP | 6.88 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.79 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|