C25H22Cl4N2O6 — CID 70306042
ethyl 4,6-dichloro-1H-indole-2-carboxylate;ethyl 4,6-dichloro-1-(2-methoxy-2-oxoethyl)indole-2-carboxylate (PubChem CID 70306042) has the molecular formula C25H22Cl4N2O6 and a molecular weight of 588.27 g/mol. Its IUPAC name is ethyl 4,6-dichloro-1H-indole-2-carboxylate;ethyl 4,6-dichloro-1-(2-methoxy-2-oxoethyl)indole-2-carboxylate.
| Compound Name | ethyl 4,6-dichloro-1H-indole-2-carboxylate;ethyl 4,6-dichloro-1-(2-methoxy-2-oxoethyl)indole-2-carboxylate |
|---|---|
| PubChem CID | 70306042 |
| Molecular Formula | C25H22Cl4N2O6 |
| Molecular Weight | 588.27 g/mol |
| Exact Mass | 586.02 |
| IUPAC Name | ethyl 4,6-dichloro-1H-indole-2-carboxylate;ethyl 4,6-dichloro-1-(2-methoxy-2-oxoethyl)indole-2-carboxylate |
| SMILES | CCOC(=O)c1cc2c(Cl)cc(Cl)cc2[nH]1.CCOC(=O)c1cc2c(Cl)cc(Cl)cc2n1CC(=O)OC |
| InChI | InChI=1S/C14H13Cl2NO4.C11H9Cl2NO2/c1-3-21-14(19)12-6-9-10(16)4-8(15)5-11(9)17(12)7-13(18)20-2;1-2-16-11(15)10-5-7-8(13)3-6(12)4-9(7)14-10/h4-6H,3,7H2,1-2H3;3-5,14H,2H2,1H3 |
| InChIKey | YLUYSJSUYIOVQS-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 99.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.27 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|