About 1-[[(1R,3S)-3-(butoxymethyl)-2,2-dimethylcyclobutyl]methyl]-4-methylpiperazine
1-[[(1R,3S)-3-(butoxymethyl)-2,2-dimethylcyclobutyl]methyl]-4-methylpiperazine (PubChem CID 70306640) has the molecular formula C17H34N2O
and a molecular weight of 282.47 g/mol. Its IUPAC name is 1-[[(1R,3S)-3-(butoxymethyl)-2,2-dimethylcyclobutyl]methyl]-4-methylpiperazine.
Molecular Properties
| Compound Name | 1-[[(1R,3S)-3-(butoxymethyl)-2,2-dimethylcyclobutyl]methyl]-4-methylpiperazine |
| PubChem CID | 70306640 |
| Molecular Formula | C17H34N2O |
| Molecular Weight | 282.47 g/mol |
| Exact Mass | 282.27 |
| IUPAC Name | 1-[[(1R,3S)-3-(butoxymethyl)-2,2-dimethylcyclobutyl]methyl]-4-methylpiperazine |
| SMILES | CCCCOC[C@H]1C[C@@H](CN2CCN(C)CC2)C1(C)C |
| InChI | InChI=1S/C17H34N2O/c1-5-6-11-20-14-16-12-15(17(16,2)3)13-19-9-7-18(4)8-10-19/h15-16H,5-14H2,1-4H3/t15-,16+/m0/s1 |
| InChIKey | UITYVPKNWBGOIG-JKSUJKDBSA-N |
| XLogP | 2.71 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.47 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-[[(1R,3S)-3-(butoxymethyl)-2,2-dimethylcyclobutyl]methyl]-4-methylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[(1R,3S)-3-(butoxymethyl)-2,2-dimethylcyclobutyl]methyl]-4-methylpiperazine?
The IUPAC name of 1-[[(1R,3S)-3-(butoxymethyl)-2,2-dimethylcyclobutyl]methyl]-4-methylpiperazine (CID 70306640) is 1-[[(1R,3S)-3-(butoxymethyl)-2,2-dimethylcyclobutyl]methyl]-4-methylpiperazine.
What is the SMILES notation for 1-[[(1R,3S)-3-(butoxymethyl)-2,2-dimethylcyclobutyl]methyl]-4-methylpiperazine?
The canonical SMILES for 1-[[(1R,3S)-3-(butoxymethyl)-2,2-dimethylcyclobutyl]methyl]-4-methylpiperazine is CCCCOC[C@H]1C[C@@H](CN2CCN(C)CC2)C1(C)C.
What is the InChIKey of 1-[[(1R,3S)-3-(butoxymethyl)-2,2-dimethylcyclobutyl]methyl]-4-methylpiperazine?
The InChIKey is UITYVPKNWBGOIG-JKSUJKDBSA-N. The full InChI is InChI=1S/C17H34N2O/c1-5-6-11-20-14-16-12-15(17(16,2)3)13-19-9-7-18(4)8-10-19/h15-16H,5-14H2,1-4H3/t15-,16+/m0/s1.
What are the key properties of 1-[[(1R,3S)-3-(butoxymethyl)-2,2-dimethylcyclobutyl]methyl]-4-methylpiperazine?
1-[[(1R,3S)-3-(butoxymethyl)-2,2-dimethylcyclobutyl]methyl]-4-methylpiperazine has a molecular weight of 282.47 g/mol, XLogP of 2.71, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[(1R,3S)-3-(butoxymethyl)-2,2-dimethylcyclobutyl]methyl]-4-methylpiperazine is sourced from PubChem (CID 70306640), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).