About benzyl 2-[(5,5-difluoro-6-methyl-4-oxo-1-phenyloct-7-en-3-yl)amino]acetate
benzyl 2-[(5,5-difluoro-6-methyl-4-oxo-1-phenyloct-7-en-3-yl)amino]acetate (PubChem CID 70306702) has the molecular formula C24H27F2NO3
and a molecular weight of 415.48 g/mol. Its IUPAC name is benzyl 2-[(5,5-difluoro-6-methyl-4-oxo-1-phenyloct-7-en-3-yl)amino]acetate.
Molecular Properties
| Compound Name | benzyl 2-[(5,5-difluoro-6-methyl-4-oxo-1-phenyloct-7-en-3-yl)amino]acetate |
| PubChem CID | 70306702 |
| Molecular Formula | C24H27F2NO3 |
| Molecular Weight | 415.48 g/mol |
| Exact Mass | 415.20 |
| IUPAC Name | benzyl 2-[(5,5-difluoro-6-methyl-4-oxo-1-phenyloct-7-en-3-yl)amino]acetate |
| SMILES | C=CC(C)C(F)(F)C(=O)C(CCc1ccccc1)NCC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C24H27F2NO3/c1-3-18(2)24(25,26)23(29)21(15-14-19-10-6-4-7-11-19)27-16-22(28)30-17-20-12-8-5-9-13-20/h3-13,18,21,27H,1,14-17H2,2H3 |
| InChIKey | AHEVPVIZLXAJSV-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 415.48 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze benzyl 2-[(5,5-difluoro-6-methyl-4-oxo-1-phenyloct-7-en-3-yl)amino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 2-[(5,5-difluoro-6-methyl-4-oxo-1-phenyloct-7-en-3-yl)amino]acetate?
The IUPAC name of benzyl 2-[(5,5-difluoro-6-methyl-4-oxo-1-phenyloct-7-en-3-yl)amino]acetate (CID 70306702) is benzyl 2-[(5,5-difluoro-6-methyl-4-oxo-1-phenyloct-7-en-3-yl)amino]acetate.
What is the SMILES notation for benzyl 2-[(5,5-difluoro-6-methyl-4-oxo-1-phenyloct-7-en-3-yl)amino]acetate?
The canonical SMILES for benzyl 2-[(5,5-difluoro-6-methyl-4-oxo-1-phenyloct-7-en-3-yl)amino]acetate is C=CC(C)C(F)(F)C(=O)C(CCc1ccccc1)NCC(=O)OCc1ccccc1.
What is the InChIKey of benzyl 2-[(5,5-difluoro-6-methyl-4-oxo-1-phenyloct-7-en-3-yl)amino]acetate?
The InChIKey is AHEVPVIZLXAJSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H27F2NO3/c1-3-18(2)24(25,26)23(29)21(15-14-19-10-6-4-7-11-19)27-16-22(28)30-17-20-12-8-5-9-13-20/h3-13,18,21,27H,1,14-17H2,2H3.
What are the key properties of benzyl 2-[(5,5-difluoro-6-methyl-4-oxo-1-phenyloct-7-en-3-yl)amino]acetate?
benzyl 2-[(5,5-difluoro-6-methyl-4-oxo-1-phenyloct-7-en-3-yl)amino]acetate has a molecular weight of 415.48 g/mol, XLogP of 4.35, 12 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 2-[(5,5-difluoro-6-methyl-4-oxo-1-phenyloct-7-en-3-yl)amino]acetate is sourced from PubChem (CID 70306702), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).