C8H10N2O2 — CID 70306734
(4R)-2,3,4,5-tetrahydro-1,2-benzoxazole-4-carboxamide (PubChem CID 70306734) has the molecular formula C8H10N2O2 and a molecular weight of 166.18 g/mol. Its IUPAC name is (4R)-2,3,4,5-tetrahydro-1,2-benzoxazole-4-carboxamide.
| Compound Name | (4R)-2,3,4,5-tetrahydro-1,2-benzoxazole-4-carboxamide |
|---|---|
| PubChem CID | 70306734 |
| Molecular Formula | C8H10N2O2 |
| Molecular Weight | 166.18 g/mol |
| Exact Mass | 166.07 |
| IUPAC Name | (4R)-2,3,4,5-tetrahydro-1,2-benzoxazole-4-carboxamide |
| SMILES | NC(=O)[C@@H]1CC=CC2=C1CNO2 |
| InChI | InChI=1S/C8H10N2O2/c9-8(11)5-2-1-3-7-6(5)4-10-12-7/h1,3,5,10H,2,4H2,(H2,9,11)/t5-/m1/s1 |
| InChIKey | LNMOILUEZLGKMQ-RXMQYKEDSA-N |
| XLogP | -0.16 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.18 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |