C20H27N7O5S2 — CID 70306846
methyl (2S)-3,3-diamino-2-(benzenesulfonyl)-5-[5-[3-(4,5-dihydro-1H-imidazol-2-ylamino)propyl]-1,3,4-thiadiazol-2-yl]-4-oxopentanoate (PubChem CID 70306846) has the molecular formula C20H27N7O5S2 and a molecular weight of 509.61 g/mol. Its IUPAC name is methyl (2S)-3,3-diamino-2-(benzenesulfonyl)-5-[5-[3-(4,5-dihydro-1H-imidazol-2-ylamino)propyl]-1,3,4-thiadiazol-2-yl]-4-oxopentanoate.
| Compound Name | methyl (2S)-3,3-diamino-2-(benzenesulfonyl)-5-[5-[3-(4,5-dihydro-1H-imidazol-2-ylamino)propyl]-1,3,4-thiadiazol-2-yl]-4-oxopentanoate |
|---|---|
| PubChem CID | 70306846 |
| Molecular Formula | C20H27N7O5S2 |
| Molecular Weight | 509.61 g/mol |
| Exact Mass | 509.15 |
| IUPAC Name | methyl (2S)-3,3-diamino-2-(benzenesulfonyl)-5-[5-[3-(4,5-dihydro-1H-imidazol-2-ylamino)propyl]-1,3,4-thiadiazol-2-yl]-4-oxopentanoate |
| SMILES | COC(=O)[C@H](C(N)(N)C(=O)Cc1nnc(CCCNC2=NCCN2)s1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C20H27N7O5S2/c1-32-18(29)17(34(30,31)13-6-3-2-4-7-13)20(21,22)14(28)12-16-27-26-15(33-16)8-5-9-23-19-24-10-11-25-19/h2-4,6-7,17H,5,8-12,21-22H2,1H3,(H2,23,24,25)/t17-/m1/s1 |
| InChIKey | FCKRYIUDGQETNG-QGZVFWFLSA-N |
| XLogP | -1.24 |
| TPSA | 191.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.61 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|