About 2-heptan-3-ylquinazoline
2-heptan-3-ylquinazoline (PubChem CID 70306859) has the molecular formula C15H20N2
and a molecular weight of 228.34 g/mol. Its IUPAC name is 2-heptan-3-ylquinazoline.
Molecular Properties
| Compound Name | 2-heptan-3-ylquinazoline |
| PubChem CID | 70306859 |
| Molecular Formula | C15H20N2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.16 |
| IUPAC Name | 2-heptan-3-ylquinazoline |
| SMILES | CCCCC(CC)c1ncc2ccccc2n1 |
| InChI | InChI=1S/C15H20N2/c1-3-5-8-12(4-2)15-16-11-13-9-6-7-10-14(13)17-15/h6-7,9-12H,3-5,8H2,1-2H3 |
| InChIKey | TWTMHWNFQUVXPL-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-heptan-3-ylquinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-heptan-3-ylquinazoline?
The IUPAC name of 2-heptan-3-ylquinazoline (CID 70306859) is 2-heptan-3-ylquinazoline.
What is the SMILES notation for 2-heptan-3-ylquinazoline?
The canonical SMILES for 2-heptan-3-ylquinazoline is CCCCC(CC)c1ncc2ccccc2n1.
What is the InChIKey of 2-heptan-3-ylquinazoline?
The InChIKey is TWTMHWNFQUVXPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20N2/c1-3-5-8-12(4-2)15-16-11-13-9-6-7-10-14(13)17-15/h6-7,9-12H,3-5,8H2,1-2H3.
What are the key properties of 2-heptan-3-ylquinazoline?
2-heptan-3-ylquinazoline has a molecular weight of 228.34 g/mol, XLogP of 4.31, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-heptan-3-ylquinazoline is sourced from PubChem (CID 70306859), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).