C16H22F3NO4Si — CID 70307052
benzyl (4S,5S)-4-methyl-5-(trifluoromethyl)-5-trimethylsilyloxy-1,3-oxazolidine-3-carboxylate (PubChem CID 70307052) has the molecular formula C16H22F3NO4Si and a molecular weight of 377.44 g/mol. Its IUPAC name is benzyl (4S,5S)-4-methyl-5-(trifluoromethyl)-5-trimethylsilyloxy-1,3-oxazolidine-3-carboxylate.
| Compound Name | benzyl (4S,5S)-4-methyl-5-(trifluoromethyl)-5-trimethylsilyloxy-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 70307052 |
| Molecular Formula | C16H22F3NO4Si |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.13 |
| IUPAC Name | benzyl (4S,5S)-4-methyl-5-(trifluoromethyl)-5-trimethylsilyloxy-1,3-oxazolidine-3-carboxylate |
| SMILES | C[C@@H]1N(C(=O)OCc2ccccc2)CO[C@@]1(O[Si](C)(C)C)C(F)(F)F |
| InChI | InChI=1S/C16H22F3NO4Si/c1-12-15(16(17,18)19,24-25(2,3)4)23-11-20(12)14(21)22-10-13-8-6-5-7-9-13/h5-9,12H,10-11H2,1-4H3/t12-,15-/m0/s1 |
| InChIKey | HTIUZXYXSRYSAI-WFASDCNBSA-N |
| XLogP | 4.11 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|