C17H18FN3O — CID 70307107
(2R,5R)-5-(5-amino-2-fluorophenyl)-5-methyl-2-phenyl-2,6-dihydro-1,4-oxazin-3-amine (PubChem CID 70307107) has the molecular formula C17H18FN3O and a molecular weight of 299.35 g/mol. Its IUPAC name is (2R,5R)-5-(5-amino-2-fluorophenyl)-5-methyl-2-phenyl-2,6-dihydro-1,4-oxazin-3-amine.
| Compound Name | (2R,5R)-5-(5-amino-2-fluorophenyl)-5-methyl-2-phenyl-2,6-dihydro-1,4-oxazin-3-amine |
|---|---|
| PubChem CID | 70307107 |
| Molecular Formula | C17H18FN3O |
| Molecular Weight | 299.35 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | (2R,5R)-5-(5-amino-2-fluorophenyl)-5-methyl-2-phenyl-2,6-dihydro-1,4-oxazin-3-amine |
| SMILES | C[C@@]1(c2cc(N)ccc2F)CO[C@H](c2ccccc2)C(N)=N1 |
| InChI | InChI=1S/C17H18FN3O/c1-17(13-9-12(19)7-8-14(13)18)10-22-15(16(20)21-17)11-5-3-2-4-6-11/h2-9,15H,10,19H2,1H3,(H2,20,21)/t15-,17+/m1/s1 |
| InChIKey | LBBOCIJPFRZACV-WBVHZDCISA-N |
| XLogP | 2.75 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.35 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|