C28H29F3N8O3 — CID 70307231
6-[(3R)-3-aminopiperidin-1-yl]-3-[(3-cyanoquinolin-2-yl)methyl]-5-ethyl-1-methyl-2,4-dioxo-N-(2,2,2-trifluoroethyl)pyrrolo[3,2-d]pyrimidine-7-carboxamide (PubChem CID 70307231) has the molecular formula C28H29F3N8O3 and a molecular weight of 582.59 g/mol. Its IUPAC name is 6-[(3R)-3-aminopiperidin-1-yl]-3-[(3-cyanoquinolin-2-yl)methyl]-5-ethyl-1-methyl-2,4-dioxo-N-(2,2,2-trifluoroethyl)pyrrolo[3,2-d]pyrimidine-7-carboxamide.
| Compound Name | 6-[(3R)-3-aminopiperidin-1-yl]-3-[(3-cyanoquinolin-2-yl)methyl]-5-ethyl-1-methyl-2,4-dioxo-N-(2,2,2-trifluoroethyl)pyrrolo[3,2-d]pyrimidine-7-carboxamide |
|---|---|
| PubChem CID | 70307231 |
| Molecular Formula | C28H29F3N8O3 |
| Molecular Weight | 582.59 g/mol |
| Exact Mass | 582.23 |
| IUPAC Name | 6-[(3R)-3-aminopiperidin-1-yl]-3-[(3-cyanoquinolin-2-yl)methyl]-5-ethyl-1-methyl-2,4-dioxo-N-(2,2,2-trifluoroethyl)pyrrolo[3,2-d]pyrimidine-7-carboxamide |
| SMILES | CCn1c(N2CCC[C@@H](N)C2)c(C(=O)NCC(F)(F)F)c2c1c(=O)n(Cc1nc3ccccc3cc1C#N)c(=O)n2C |
| InChI | InChI=1S/C28H29F3N8O3/c1-3-38-23-22(21(24(40)34-15-28(29,30)31)25(38)37-10-6-8-18(33)13-37)36(2)27(42)39(26(23)41)14-20-17(12-32)11-16-7-4-5-9-19(16)35-20/h4-5,7,9,11,18H,3,6,8,10,13-15,33H2,1-2H3,(H,34,40)/t18-/m1/s1 |
| InChIKey | JRMCQPIZIJPLFW-GOSISDBHSA-N |
| XLogP | 2.21 |
| TPSA | 143.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.59 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |