About 2,7-difluoro-3,4-dihydrofluoren-9-imine
2,7-difluoro-3,4-dihydrofluoren-9-imine (PubChem CID 70307599) has the molecular formula C13H9F2N
and a molecular weight of 217.22 g/mol. Its IUPAC name is 2,7-difluoro-3,4-dihydrofluoren-9-imine.
Molecular Properties
| Compound Name | 2,7-difluoro-3,4-dihydrofluoren-9-imine |
| PubChem CID | 70307599 |
| Molecular Formula | C13H9F2N |
| Molecular Weight | 217.22 g/mol |
| Exact Mass | 217.07 |
| IUPAC Name | 2,7-difluoro-3,4-dihydrofluoren-9-imine |
| SMILES | [H]/N=C1/C2=C(CCC(F)=C2)c2ccc(F)cc21 |
| InChI | InChI=1S/C13H9F2N/c14-7-1-3-9-10-4-2-8(15)6-12(10)13(16)11(9)5-7/h1,3,5-6,16H,2,4H2/b16-13+ |
| InChIKey | UWWGKXDUYADKAC-DTQAZKPQSA-N |
| XLogP | 3.61 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.22 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2,7-difluoro-3,4-dihydrofluoren-9-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,7-difluoro-3,4-dihydrofluoren-9-imine?
The IUPAC name of 2,7-difluoro-3,4-dihydrofluoren-9-imine (CID 70307599) is 2,7-difluoro-3,4-dihydrofluoren-9-imine.
What is the SMILES notation for 2,7-difluoro-3,4-dihydrofluoren-9-imine?
The canonical SMILES for 2,7-difluoro-3,4-dihydrofluoren-9-imine is [H]/N=C1/C2=C(CCC(F)=C2)c2ccc(F)cc21.
What is the InChIKey of 2,7-difluoro-3,4-dihydrofluoren-9-imine?
The InChIKey is UWWGKXDUYADKAC-DTQAZKPQSA-N. The full InChI is InChI=1S/C13H9F2N/c14-7-1-3-9-10-4-2-8(15)6-12(10)13(16)11(9)5-7/h1,3,5-6,16H,2,4H2/b16-13+.
What are the key properties of 2,7-difluoro-3,4-dihydrofluoren-9-imine?
2,7-difluoro-3,4-dihydrofluoren-9-imine has a molecular weight of 217.22 g/mol, XLogP of 3.61, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,7-difluoro-3,4-dihydrofluoren-9-imine is sourced from PubChem (CID 70307599), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).