About 6-methoxy-2,3-dihydrochromen-4-imine
6-methoxy-2,3-dihydrochromen-4-imine (PubChem CID 70307921) has the molecular formula C10H11NO2
and a molecular weight of 177.20 g/mol. Its IUPAC name is 6-methoxy-2,3-dihydrochromen-4-imine.
Molecular Properties
| Compound Name | 6-methoxy-2,3-dihydrochromen-4-imine |
| PubChem CID | 70307921 |
| Molecular Formula | C10H11NO2 |
| Molecular Weight | 177.20 g/mol |
| Exact Mass | 177.08 |
| IUPAC Name | 6-methoxy-2,3-dihydrochromen-4-imine |
| SMILES | [H]/N=C1\CCOc2ccc(OC)cc21 |
| InChI | InChI=1S/C10H11NO2/c1-12-7-2-3-10-8(6-7)9(11)4-5-13-10/h2-3,6,11H,4-5H2,1H3/b11-9+ |
| InChIKey | IPYXSOUOWUNOKM-PKNBQFBNSA-N |
| XLogP | 1.85 |
| TPSA | 42.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.20 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 6-methoxy-2,3-dihydrochromen-4-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methoxy-2,3-dihydrochromen-4-imine?
The IUPAC name of 6-methoxy-2,3-dihydrochromen-4-imine (CID 70307921) is 6-methoxy-2,3-dihydrochromen-4-imine.
What is the SMILES notation for 6-methoxy-2,3-dihydrochromen-4-imine?
The canonical SMILES for 6-methoxy-2,3-dihydrochromen-4-imine is [H]/N=C1\CCOc2ccc(OC)cc21.
What is the InChIKey of 6-methoxy-2,3-dihydrochromen-4-imine?
The InChIKey is IPYXSOUOWUNOKM-PKNBQFBNSA-N. The full InChI is InChI=1S/C10H11NO2/c1-12-7-2-3-10-8(6-7)9(11)4-5-13-10/h2-3,6,11H,4-5H2,1H3/b11-9+.
What are the key properties of 6-methoxy-2,3-dihydrochromen-4-imine?
6-methoxy-2,3-dihydrochromen-4-imine has a molecular weight of 177.20 g/mol, XLogP of 1.85, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methoxy-2,3-dihydrochromen-4-imine is sourced from PubChem (CID 70307921), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).