About 5,5-dimethylfuro[3,2-b]azepine
5,5-dimethylfuro[3,2-b]azepine (PubChem CID 70308181) has the molecular formula C10H11NO
and a molecular weight of 161.20 g/mol. Its IUPAC name is 5,5-dimethylfuro[3,2-b]azepine.
Molecular Properties
| Compound Name | 5,5-dimethylfuro[3,2-b]azepine |
| PubChem CID | 70308181 |
| Molecular Formula | C10H11NO |
| Molecular Weight | 161.20 g/mol |
| Exact Mass | 161.08 |
| IUPAC Name | 5,5-dimethylfuro[3,2-b]azepine |
| SMILES | CC1(C)C=CC=c2occc2=N1 |
| InChI | InChI=1S/C10H11NO/c1-10(2)6-3-4-9-8(11-10)5-7-12-9/h3-7H,1-2H3 |
| InChIKey | OQQVSQONYDHPSG-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 25.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.20 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5,5-dimethylfuro[3,2-b]azepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,5-dimethylfuro[3,2-b]azepine?
The IUPAC name of 5,5-dimethylfuro[3,2-b]azepine (CID 70308181) is 5,5-dimethylfuro[3,2-b]azepine.
What is the SMILES notation for 5,5-dimethylfuro[3,2-b]azepine?
The canonical SMILES for 5,5-dimethylfuro[3,2-b]azepine is CC1(C)C=CC=c2occc2=N1.
What is the InChIKey of 5,5-dimethylfuro[3,2-b]azepine?
The InChIKey is OQQVSQONYDHPSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO/c1-10(2)6-3-4-9-8(11-10)5-7-12-9/h3-7H,1-2H3.
What are the key properties of 5,5-dimethylfuro[3,2-b]azepine?
5,5-dimethylfuro[3,2-b]azepine has a molecular weight of 161.20 g/mol, XLogP of 1.03, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5-dimethylfuro[3,2-b]azepine is sourced from PubChem (CID 70308181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).