C16H21NO4 — CID 70308380
(2R,6R,8S,9R)-11-benzyl-4,4-dimethyl-3,5,7-trioxa-11-azatricyclo[6.3.0.02,6]undecan-9-ol (PubChem CID 70308380) has the molecular formula C16H21NO4 and a molecular weight of 291.35 g/mol. Its IUPAC name is (2R,6R,8S,9R)-11-benzyl-4,4-dimethyl-3,5,7-trioxa-11-azatricyclo[6.3.0.02,6]undecan-9-ol.
| Compound Name | (2R,6R,8S,9R)-11-benzyl-4,4-dimethyl-3,5,7-trioxa-11-azatricyclo[6.3.0.02,6]undecan-9-ol |
|---|---|
| PubChem CID | 70308380 |
| Molecular Formula | C16H21NO4 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | (2R,6R,8S,9R)-11-benzyl-4,4-dimethyl-3,5,7-trioxa-11-azatricyclo[6.3.0.02,6]undecan-9-ol |
| SMILES | CC1(C)O[C@H]2O[C@H]3C([C@H]2O1)N(Cc1ccccc1)C[C@H]3O |
| InChI | InChI=1S/C16H21NO4/c1-16(2)20-14-12-13(19-15(14)21-16)11(18)9-17(12)8-10-6-4-3-5-7-10/h3-7,11-15,18H,8-9H2,1-2H3/t11-,12?,13-,14-,15-/m1/s1 |
| InChIKey | SLFMYTIRWZKYGZ-NERRFYNHSA-N |
| XLogP | 1.11 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |