C22H33N4+ — CID 7030849
3-(2-tert-butylimidazo[1,2-a]benzimidazol-3-yl)propyl-cyclohexylazanium (PubChem CID 7030849) has the molecular formula C22H33N4+ and a molecular weight of 353.53 g/mol. Its IUPAC name is 3-(2-tert-butylimidazo[1,2-a]benzimidazol-3-yl)propyl-cyclohexylazanium.
| Compound Name | 3-(2-tert-butylimidazo[1,2-a]benzimidazol-3-yl)propyl-cyclohexylazanium |
|---|---|
| PubChem CID | 7030849 |
| Molecular Formula | C22H33N4+ |
| Molecular Weight | 353.53 g/mol |
| Exact Mass | 353.27 |
| IUPAC Name | 3-(2-tert-butylimidazo[1,2-a]benzimidazol-3-yl)propyl-cyclohexylazanium |
| SMILES | CC(C)(C)c1cn2c3ccccc3nc2n1CCC[NH2+]C1CCCCC1 |
| InChI | InChI=1S/C22H32N4/c1-22(2,3)20-16-26-19-13-8-7-12-18(19)24-21(26)25(20)15-9-14-23-17-10-5-4-6-11-17/h7-8,12-13,16-17,23H,4-6,9-11,14-15H2,1-3H3/p+1 |
| InChIKey | JOLKDLHFKMOEOG-UHFFFAOYSA-O |
| XLogP | 3.87 |
| TPSA | 38.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.53 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|