About 2-prop-1-en-2-yl-2,3-dihydropyridine
2-prop-1-en-2-yl-2,3-dihydropyridine (PubChem CID 70308527) has the molecular formula C8H11N
and a molecular weight of 121.18 g/mol. Its IUPAC name is 2-prop-1-en-2-yl-2,3-dihydropyridine.
Molecular Properties
| Compound Name | 2-prop-1-en-2-yl-2,3-dihydropyridine |
| PubChem CID | 70308527 |
| Molecular Formula | C8H11N |
| Molecular Weight | 121.18 g/mol |
| Exact Mass | 121.09 |
| IUPAC Name | 2-prop-1-en-2-yl-2,3-dihydropyridine |
| SMILES | C=C(C)C1CC=CC=N1 |
| InChI | InChI=1S/C8H11N/c1-7(2)8-5-3-4-6-9-8/h3-4,6,8H,1,5H2,2H3 |
| InChIKey | DEMOGGZOJPFZRJ-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 121.18 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-prop-1-en-2-yl-2,3-dihydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-prop-1-en-2-yl-2,3-dihydropyridine?
The IUPAC name of 2-prop-1-en-2-yl-2,3-dihydropyridine (CID 70308527) is 2-prop-1-en-2-yl-2,3-dihydropyridine.
What is the SMILES notation for 2-prop-1-en-2-yl-2,3-dihydropyridine?
The canonical SMILES for 2-prop-1-en-2-yl-2,3-dihydropyridine is C=C(C)C1CC=CC=N1.
What is the InChIKey of 2-prop-1-en-2-yl-2,3-dihydropyridine?
The InChIKey is DEMOGGZOJPFZRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N/c1-7(2)8-5-3-4-6-9-8/h3-4,6,8H,1,5H2,2H3.
What are the key properties of 2-prop-1-en-2-yl-2,3-dihydropyridine?
2-prop-1-en-2-yl-2,3-dihydropyridine has a molecular weight of 121.18 g/mol, XLogP of 1.96, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-prop-1-en-2-yl-2,3-dihydropyridine is sourced from PubChem (CID 70308527), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).