About 1-cyclohexa-1,5-dien-1-yl-4-(iodomethyl)benzene
1-cyclohexa-1,5-dien-1-yl-4-(iodomethyl)benzene (PubChem CID 70308724) has the molecular formula C13H13I
and a molecular weight of 296.15 g/mol. Its IUPAC name is 1-cyclohexa-1,5-dien-1-yl-4-(iodomethyl)benzene.
Molecular Properties
| Compound Name | 1-cyclohexa-1,5-dien-1-yl-4-(iodomethyl)benzene |
| PubChem CID | 70308724 |
| Molecular Formula | C13H13I |
| Molecular Weight | 296.15 g/mol |
| Exact Mass | 296.01 |
| IUPAC Name | 1-cyclohexa-1,5-dien-1-yl-4-(iodomethyl)benzene |
| SMILES | ICc1ccc(C2=CCCC=C2)cc1 |
| InChI | InChI=1S/C13H13I/c14-10-11-6-8-13(9-7-11)12-4-2-1-3-5-12/h2,4-9H,1,3,10H2 |
| InChIKey | UIZUSYGUWKXKQR-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.15 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1-cyclohexa-1,5-dien-1-yl-4-(iodomethyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexa-1,5-dien-1-yl-4-(iodomethyl)benzene?
The IUPAC name of 1-cyclohexa-1,5-dien-1-yl-4-(iodomethyl)benzene (CID 70308724) is 1-cyclohexa-1,5-dien-1-yl-4-(iodomethyl)benzene.
What is the SMILES notation for 1-cyclohexa-1,5-dien-1-yl-4-(iodomethyl)benzene?
The canonical SMILES for 1-cyclohexa-1,5-dien-1-yl-4-(iodomethyl)benzene is ICc1ccc(C2=CCCC=C2)cc1.
What is the InChIKey of 1-cyclohexa-1,5-dien-1-yl-4-(iodomethyl)benzene?
The InChIKey is UIZUSYGUWKXKQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13I/c14-10-11-6-8-13(9-7-11)12-4-2-1-3-5-12/h2,4-9H,1,3,10H2.
What are the key properties of 1-cyclohexa-1,5-dien-1-yl-4-(iodomethyl)benzene?
1-cyclohexa-1,5-dien-1-yl-4-(iodomethyl)benzene has a molecular weight of 296.15 g/mol, XLogP of 4.36, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexa-1,5-dien-1-yl-4-(iodomethyl)benzene is sourced from PubChem (CID 70308724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).