C6H12N4 — CID 70309801
1,2,3,4,4a,5,6,7-octahydro-1,2,3,4-benzotetrazine (PubChem CID 70309801) has the molecular formula C6H12N4 and a molecular weight of 140.19 g/mol. Its IUPAC name is 1,2,3,4,4a,5,6,7-octahydro-1,2,3,4-benzotetrazine.
| Compound Name | 1,2,3,4,4a,5,6,7-octahydro-1,2,3,4-benzotetrazine |
|---|---|
| PubChem CID | 70309801 |
| Molecular Formula | C6H12N4 |
| Molecular Weight | 140.19 g/mol |
| Exact Mass | 140.11 |
| IUPAC Name | 1,2,3,4,4a,5,6,7-octahydro-1,2,3,4-benzotetrazine |
| SMILES | C1=C2NNNNC2CCC1 |
| InChI | InChI=1S/C6H12N4/c1-2-4-6-5(3-1)7-9-10-8-6/h3,6-10H,1-2,4H2 |
| InChIKey | PMVBCOQBVJSIMM-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.19 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |