About 5,5-dimethyl-1H-pyrrolo[3,2-b]azepine
5,5-dimethyl-1H-pyrrolo[3,2-b]azepine (PubChem CID 70309809) has the molecular formula C10H12N2
and a molecular weight of 160.22 g/mol. Its IUPAC name is 5,5-dimethyl-1H-pyrrolo[3,2-b]azepine.
Molecular Properties
| Compound Name | 5,5-dimethyl-1H-pyrrolo[3,2-b]azepine |
| PubChem CID | 70309809 |
| Molecular Formula | C10H12N2 |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.10 |
| IUPAC Name | 5,5-dimethyl-1H-pyrrolo[3,2-b]azepine |
| SMILES | CC1(C)C=CC=c2[nH]ccc2=N1 |
| InChI | InChI=1S/C10H12N2/c1-10(2)6-3-4-8-9(12-10)5-7-11-8/h3-7,11H,1-2H3 |
| InChIKey | HORNZQBFQYSINX-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 28.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5,5-dimethyl-1H-pyrrolo[3,2-b]azepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,5-dimethyl-1H-pyrrolo[3,2-b]azepine?
The IUPAC name of 5,5-dimethyl-1H-pyrrolo[3,2-b]azepine (CID 70309809) is 5,5-dimethyl-1H-pyrrolo[3,2-b]azepine.
What is the SMILES notation for 5,5-dimethyl-1H-pyrrolo[3,2-b]azepine?
The canonical SMILES for 5,5-dimethyl-1H-pyrrolo[3,2-b]azepine is CC1(C)C=CC=c2[nH]ccc2=N1.
What is the InChIKey of 5,5-dimethyl-1H-pyrrolo[3,2-b]azepine?
The InChIKey is HORNZQBFQYSINX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2/c1-10(2)6-3-4-8-9(12-10)5-7-11-8/h3-7,11H,1-2H3.
What are the key properties of 5,5-dimethyl-1H-pyrrolo[3,2-b]azepine?
5,5-dimethyl-1H-pyrrolo[3,2-b]azepine has a molecular weight of 160.22 g/mol, XLogP of 0.76, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5-dimethyl-1H-pyrrolo[3,2-b]azepine is sourced from PubChem (CID 70309809), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).