About 5,6-dimethyl-5-propyl-7-(trifluoromethyl)-2,6-dihydroazepine
5,6-dimethyl-5-propyl-7-(trifluoromethyl)-2,6-dihydroazepine (PubChem CID 70309949) has the molecular formula C12H18F3N
and a molecular weight of 233.28 g/mol. Its IUPAC name is 5,6-dimethyl-5-propyl-7-(trifluoromethyl)-2,6-dihydroazepine.
Molecular Properties
| Compound Name | 5,6-dimethyl-5-propyl-7-(trifluoromethyl)-2,6-dihydroazepine |
| PubChem CID | 70309949 |
| Molecular Formula | C12H18F3N |
| Molecular Weight | 233.28 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | 5,6-dimethyl-5-propyl-7-(trifluoromethyl)-2,6-dihydroazepine |
| SMILES | CCCC1(C)C=CCN=C(C(F)(F)F)C1C |
| InChI | InChI=1S/C12H18F3N/c1-4-6-11(3)7-5-8-16-10(9(11)2)12(13,14)15/h5,7,9H,4,6,8H2,1-3H3 |
| InChIKey | ZFOVZDXYKVEZHM-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.28 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5,6-dimethyl-5-propyl-7-(trifluoromethyl)-2,6-dihydroazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-dimethyl-5-propyl-7-(trifluoromethyl)-2,6-dihydroazepine?
The IUPAC name of 5,6-dimethyl-5-propyl-7-(trifluoromethyl)-2,6-dihydroazepine (CID 70309949) is 5,6-dimethyl-5-propyl-7-(trifluoromethyl)-2,6-dihydroazepine.
What is the SMILES notation for 5,6-dimethyl-5-propyl-7-(trifluoromethyl)-2,6-dihydroazepine?
The canonical SMILES for 5,6-dimethyl-5-propyl-7-(trifluoromethyl)-2,6-dihydroazepine is CCCC1(C)C=CCN=C(C(F)(F)F)C1C.
What is the InChIKey of 5,6-dimethyl-5-propyl-7-(trifluoromethyl)-2,6-dihydroazepine?
The InChIKey is ZFOVZDXYKVEZHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18F3N/c1-4-6-11(3)7-5-8-16-10(9(11)2)12(13,14)15/h5,7,9H,4,6,8H2,1-3H3.
What are the key properties of 5,6-dimethyl-5-propyl-7-(trifluoromethyl)-2,6-dihydroazepine?
5,6-dimethyl-5-propyl-7-(trifluoromethyl)-2,6-dihydroazepine has a molecular weight of 233.28 g/mol, XLogP of 4.00, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dimethyl-5-propyl-7-(trifluoromethyl)-2,6-dihydroazepine is sourced from PubChem (CID 70309949), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).