About 5-bromo-1H-indole;5-phenylmethoxy-1H-indole
5-bromo-1H-indole;5-phenylmethoxy-1H-indole (PubChem CID 70310428) has the molecular formula C23H19BrN2O
and a molecular weight of 419.32 g/mol. Its IUPAC name is 5-bromo-1H-indole;5-phenylmethoxy-1H-indole.
Molecular Properties
| Compound Name | 5-bromo-1H-indole;5-phenylmethoxy-1H-indole |
| PubChem CID | 70310428 |
| Molecular Formula | C23H19BrN2O |
| Molecular Weight | 419.32 g/mol |
| Exact Mass | 418.07 |
| IUPAC Name | 5-bromo-1H-indole;5-phenylmethoxy-1H-indole |
| SMILES | Brc1ccc2[nH]ccc2c1.c1ccc(COc2ccc3[nH]ccc3c2)cc1 |
| InChI | InChI=1S/C15H13NO.C8H6BrN/c1-2-4-12(5-3-1)11-17-14-6-7-15-13(10-14)8-9-16-15;9-7-1-2-8-6(5-7)3-4-10-8/h1-10,16H,11H2;1-5,10H |
| InChIKey | QURLUYJDSGEILJ-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 40.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 419.32 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-bromo-1H-indole;5-phenylmethoxy-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-1H-indole;5-phenylmethoxy-1H-indole?
The IUPAC name of 5-bromo-1H-indole;5-phenylmethoxy-1H-indole (CID 70310428) is 5-bromo-1H-indole;5-phenylmethoxy-1H-indole.
What is the SMILES notation for 5-bromo-1H-indole;5-phenylmethoxy-1H-indole?
The canonical SMILES for 5-bromo-1H-indole;5-phenylmethoxy-1H-indole is Brc1ccc2[nH]ccc2c1.c1ccc(COc2ccc3[nH]ccc3c2)cc1.
What is the InChIKey of 5-bromo-1H-indole;5-phenylmethoxy-1H-indole?
The InChIKey is QURLUYJDSGEILJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13NO.C8H6BrN/c1-2-4-12(5-3-1)11-17-14-6-7-15-13(10-14)8-9-16-15;9-7-1-2-8-6(5-7)3-4-10-8/h1-10,16H,11H2;1-5,10H.
What are the key properties of 5-bromo-1H-indole;5-phenylmethoxy-1H-indole?
5-bromo-1H-indole;5-phenylmethoxy-1H-indole has a molecular weight of 419.32 g/mol, XLogP of 6.68, 3 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-1H-indole;5-phenylmethoxy-1H-indole is sourced from PubChem (CID 70310428), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).