About trans-(1S,2S)-2-N-piperidin-4-yl-1-N-prop-2-enylcyclohexane-1,2-diamine
trans-(1S,2S)-2-N-piperidin-4-yl-1-N-prop-2-enylcyclohexane-1,2-diamine (PubChem CID 70310438) has the molecular formula C14H27N3
and a molecular weight of 237.39 g/mol. Its IUPAC name is trans-(1S,2S)-2-N-piperidin-4-yl-1-N-prop-2-enylcyclohexane-1,2-diamine.
Molecular Properties
| Compound Name | trans-(1S,2S)-2-N-piperidin-4-yl-1-N-prop-2-enylcyclohexane-1,2-diamine |
| PubChem CID | 70310438 |
| Molecular Formula | C14H27N3 |
| Molecular Weight | 237.39 g/mol |
| Exact Mass | 237.22 |
| IUPAC Name | trans-(1S,2S)-2-N-piperidin-4-yl-1-N-prop-2-enylcyclohexane-1,2-diamine |
| SMILES | C=CCN[C@H]1CCCC[C@@H]1NC1CCNCC1 |
| InChI | InChI=1S/C14H27N3/c1-2-9-16-13-5-3-4-6-14(13)17-12-7-10-15-11-8-12/h2,12-17H,1,3-11H2/t13-,14-/m0/s1 |
| InChIKey | FEUKPDCZRIHCGP-KBPBESRZSA-N |
| XLogP | 1.41 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.39 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze trans-(1S,2S)-2-N-piperidin-4-yl-1-N-prop-2-enylcyclohexane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-(1S,2S)-2-N-piperidin-4-yl-1-N-prop-2-enylcyclohexane-1,2-diamine?
The IUPAC name of trans-(1S,2S)-2-N-piperidin-4-yl-1-N-prop-2-enylcyclohexane-1,2-diamine (CID 70310438) is trans-(1S,2S)-2-N-piperidin-4-yl-1-N-prop-2-enylcyclohexane-1,2-diamine.
What is the SMILES notation for trans-(1S,2S)-2-N-piperidin-4-yl-1-N-prop-2-enylcyclohexane-1,2-diamine?
The canonical SMILES for trans-(1S,2S)-2-N-piperidin-4-yl-1-N-prop-2-enylcyclohexane-1,2-diamine is C=CCN[C@H]1CCCC[C@@H]1NC1CCNCC1.
What is the InChIKey of trans-(1S,2S)-2-N-piperidin-4-yl-1-N-prop-2-enylcyclohexane-1,2-diamine?
The InChIKey is FEUKPDCZRIHCGP-KBPBESRZSA-N. The full InChI is InChI=1S/C14H27N3/c1-2-9-16-13-5-3-4-6-14(13)17-12-7-10-15-11-8-12/h2,12-17H,1,3-11H2/t13-,14-/m0/s1.
What are the key properties of trans-(1S,2S)-2-N-piperidin-4-yl-1-N-prop-2-enylcyclohexane-1,2-diamine?
trans-(1S,2S)-2-N-piperidin-4-yl-1-N-prop-2-enylcyclohexane-1,2-diamine has a molecular weight of 237.39 g/mol, XLogP of 1.41, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(1S,2S)-2-N-piperidin-4-yl-1-N-prop-2-enylcyclohexane-1,2-diamine is sourced from PubChem (CID 70310438), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).