About 5-ethyl-1,3,4,5-tetramethyl-4H-benzimidazol-2-one
5-ethyl-1,3,4,5-tetramethyl-4H-benzimidazol-2-one (PubChem CID 70310654) has the molecular formula C13H20N2O
and a molecular weight of 220.32 g/mol. Its IUPAC name is 5-ethyl-1,3,4,5-tetramethyl-4H-benzimidazol-2-one.
Molecular Properties
| Compound Name | 5-ethyl-1,3,4,5-tetramethyl-4H-benzimidazol-2-one |
| PubChem CID | 70310654 |
| Molecular Formula | C13H20N2O |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.16 |
| IUPAC Name | 5-ethyl-1,3,4,5-tetramethyl-4H-benzimidazol-2-one |
| SMILES | CCC1(C)C=Cc2c(n(C)c(=O)n2C)C1C |
| InChI | InChI=1S/C13H20N2O/c1-6-13(3)8-7-10-11(9(13)2)15(5)12(16)14(10)4/h7-9H,6H2,1-5H3 |
| InChIKey | WESYWNPWCWMXJI-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 26.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-ethyl-1,3,4,5-tetramethyl-4H-benzimidazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-1,3,4,5-tetramethyl-4H-benzimidazol-2-one?
The IUPAC name of 5-ethyl-1,3,4,5-tetramethyl-4H-benzimidazol-2-one (CID 70310654) is 5-ethyl-1,3,4,5-tetramethyl-4H-benzimidazol-2-one.
What is the SMILES notation for 5-ethyl-1,3,4,5-tetramethyl-4H-benzimidazol-2-one?
The canonical SMILES for 5-ethyl-1,3,4,5-tetramethyl-4H-benzimidazol-2-one is CCC1(C)C=Cc2c(n(C)c(=O)n2C)C1C.
What is the InChIKey of 5-ethyl-1,3,4,5-tetramethyl-4H-benzimidazol-2-one?
The InChIKey is WESYWNPWCWMXJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N2O/c1-6-13(3)8-7-10-11(9(13)2)15(5)12(16)14(10)4/h7-9H,6H2,1-5H3.
What are the key properties of 5-ethyl-1,3,4,5-tetramethyl-4H-benzimidazol-2-one?
5-ethyl-1,3,4,5-tetramethyl-4H-benzimidazol-2-one has a molecular weight of 220.32 g/mol, XLogP of 2.27, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-1,3,4,5-tetramethyl-4H-benzimidazol-2-one is sourced from PubChem (CID 70310654), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).