C17H20FNO5 — CID 70310665
[(2R,3R,6R,6aS)-2-acetyloxy-4-benzyl-6-fluoro-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrol-3-yl] acetate (PubChem CID 70310665) has the molecular formula C17H20FNO5 and a molecular weight of 337.35 g/mol. Its IUPAC name is [(2R,3R,6R,6aS)-2-acetyloxy-4-benzyl-6-fluoro-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrol-3-yl] acetate.
| Compound Name | [(2R,3R,6R,6aS)-2-acetyloxy-4-benzyl-6-fluoro-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrol-3-yl] acetate |
|---|---|
| PubChem CID | 70310665 |
| Molecular Formula | C17H20FNO5 |
| Molecular Weight | 337.35 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | [(2R,3R,6R,6aS)-2-acetyloxy-4-benzyl-6-fluoro-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrol-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1O[C@H]2C([C@H]1OC(C)=O)N(Cc1ccccc1)C[C@H]2F |
| InChI | InChI=1S/C17H20FNO5/c1-10(20)22-16-14-15(24-17(16)23-11(2)21)13(18)9-19(14)8-12-6-4-3-5-7-12/h3-7,13-17H,8-9H2,1-2H3/t13-,14?,15-,16-,17+/m1/s1 |
| InChIKey | YXKZTYOVTVCXOR-GTGZTVCESA-N |
| XLogP | 1.43 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.35 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |