About 2-(4,5-dimethoxycyclohexa-1,5-dien-1-yl)ethanamine
2-(4,5-dimethoxycyclohexa-1,5-dien-1-yl)ethanamine (PubChem CID 70310736) has the molecular formula C10H17NO2
and a molecular weight of 183.25 g/mol. Its IUPAC name is 2-(4,5-dimethoxycyclohexa-1,5-dien-1-yl)ethanamine.
Molecular Properties
| Compound Name | 2-(4,5-dimethoxycyclohexa-1,5-dien-1-yl)ethanamine |
| PubChem CID | 70310736 |
| Molecular Formula | C10H17NO2 |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.13 |
| IUPAC Name | 2-(4,5-dimethoxycyclohexa-1,5-dien-1-yl)ethanamine |
| SMILES | COC1=CC(CCN)=CCC1OC |
| InChI | InChI=1S/C10H17NO2/c1-12-9-4-3-8(5-6-11)7-10(9)13-2/h3,7,9H,4-6,11H2,1-2H3 |
| InChIKey | QUUWJWIGEQQILP-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(4,5-dimethoxycyclohexa-1,5-dien-1-yl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,5-dimethoxycyclohexa-1,5-dien-1-yl)ethanamine?
The IUPAC name of 2-(4,5-dimethoxycyclohexa-1,5-dien-1-yl)ethanamine (CID 70310736) is 2-(4,5-dimethoxycyclohexa-1,5-dien-1-yl)ethanamine.
What is the SMILES notation for 2-(4,5-dimethoxycyclohexa-1,5-dien-1-yl)ethanamine?
The canonical SMILES for 2-(4,5-dimethoxycyclohexa-1,5-dien-1-yl)ethanamine is COC1=CC(CCN)=CCC1OC.
What is the InChIKey of 2-(4,5-dimethoxycyclohexa-1,5-dien-1-yl)ethanamine?
The InChIKey is QUUWJWIGEQQILP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NO2/c1-12-9-4-3-8(5-6-11)7-10(9)13-2/h3,7,9H,4-6,11H2,1-2H3.
What are the key properties of 2-(4,5-dimethoxycyclohexa-1,5-dien-1-yl)ethanamine?
2-(4,5-dimethoxycyclohexa-1,5-dien-1-yl)ethanamine has a molecular weight of 183.25 g/mol, XLogP of 1.21, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,5-dimethoxycyclohexa-1,5-dien-1-yl)ethanamine is sourced from PubChem (CID 70310736), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).