About (2R)-2-(2,4,5-trifluorophenyl)oxan-3-amine
(2R)-2-(2,4,5-trifluorophenyl)oxan-3-amine (PubChem CID 70310861) has the molecular formula C11H12F3NO
and a molecular weight of 231.22 g/mol. Its IUPAC name is (2R)-2-(2,4,5-trifluorophenyl)oxan-3-amine.
Molecular Properties
| Compound Name | (2R)-2-(2,4,5-trifluorophenyl)oxan-3-amine |
| PubChem CID | 70310861 |
| Molecular Formula | C11H12F3NO |
| Molecular Weight | 231.22 g/mol |
| Exact Mass | 231.09 |
| IUPAC Name | (2R)-2-(2,4,5-trifluorophenyl)oxan-3-amine |
| SMILES | NC1CCCO[C@@H]1c1cc(F)c(F)cc1F |
| InChI | InChI=1S/C11H12F3NO/c12-7-5-9(14)8(13)4-6(7)11-10(15)2-1-3-16-11/h4-5,10-11H,1-3,15H2/t10?,11-/m1/s1 |
| InChIKey | DBIMQFVGCKJZLE-RRKGBCIJSA-N |
| XLogP | 2.28 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.22 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze (2R)-2-(2,4,5-trifluorophenyl)oxan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-(2,4,5-trifluorophenyl)oxan-3-amine?
The IUPAC name of (2R)-2-(2,4,5-trifluorophenyl)oxan-3-amine (CID 70310861) is (2R)-2-(2,4,5-trifluorophenyl)oxan-3-amine.
What is the SMILES notation for (2R)-2-(2,4,5-trifluorophenyl)oxan-3-amine?
The canonical SMILES for (2R)-2-(2,4,5-trifluorophenyl)oxan-3-amine is NC1CCCO[C@@H]1c1cc(F)c(F)cc1F.
What is the InChIKey of (2R)-2-(2,4,5-trifluorophenyl)oxan-3-amine?
The InChIKey is DBIMQFVGCKJZLE-RRKGBCIJSA-N. The full InChI is InChI=1S/C11H12F3NO/c12-7-5-9(14)8(13)4-6(7)11-10(15)2-1-3-16-11/h4-5,10-11H,1-3,15H2/t10?,11-/m1/s1.
What are the key properties of (2R)-2-(2,4,5-trifluorophenyl)oxan-3-amine?
(2R)-2-(2,4,5-trifluorophenyl)oxan-3-amine has a molecular weight of 231.22 g/mol, XLogP of 2.28, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-(2,4,5-trifluorophenyl)oxan-3-amine is sourced from PubChem (CID 70310861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).