About 3-ethyl-4-(1,2,4-triazol-1-yl)pyridine
3-ethyl-4-(1,2,4-triazol-1-yl)pyridine (PubChem CID 70310862) has the molecular formula C9H10N4
and a molecular weight of 174.21 g/mol. Its IUPAC name is 3-ethyl-4-(1,2,4-triazol-1-yl)pyridine.
Molecular Properties
| Compound Name | 3-ethyl-4-(1,2,4-triazol-1-yl)pyridine |
| PubChem CID | 70310862 |
| Molecular Formula | C9H10N4 |
| Molecular Weight | 174.21 g/mol |
| Exact Mass | 174.09 |
| IUPAC Name | 3-ethyl-4-(1,2,4-triazol-1-yl)pyridine |
| SMILES | CCc1cnccc1-n1cncn1 |
| InChI | InChI=1S/C9H10N4/c1-2-8-5-10-4-3-9(8)13-7-11-6-12-13/h3-7H,2H2,1H3 |
| InChIKey | FNKHLPPNCRQYPV-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.21 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-ethyl-4-(1,2,4-triazol-1-yl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-4-(1,2,4-triazol-1-yl)pyridine?
The IUPAC name of 3-ethyl-4-(1,2,4-triazol-1-yl)pyridine (CID 70310862) is 3-ethyl-4-(1,2,4-triazol-1-yl)pyridine.
What is the SMILES notation for 3-ethyl-4-(1,2,4-triazol-1-yl)pyridine?
The canonical SMILES for 3-ethyl-4-(1,2,4-triazol-1-yl)pyridine is CCc1cnccc1-n1cncn1.
What is the InChIKey of 3-ethyl-4-(1,2,4-triazol-1-yl)pyridine?
The InChIKey is FNKHLPPNCRQYPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N4/c1-2-8-5-10-4-3-9(8)13-7-11-6-12-13/h3-7H,2H2,1H3.
What are the key properties of 3-ethyl-4-(1,2,4-triazol-1-yl)pyridine?
3-ethyl-4-(1,2,4-triazol-1-yl)pyridine has a molecular weight of 174.21 g/mol, XLogP of 1.22, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-4-(1,2,4-triazol-1-yl)pyridine is sourced from PubChem (CID 70310862), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).