C19H31NO5 — CID 70311244
(3aR,6R,6aS)-2-butoxy-6-[(S)-[(1S)-cyclohex-2-en-1-yl]-hydroxymethyl]-6-(hydroxymethyl)-6a-methyl-2,3,3a,5-tetrahydrofuro[2,3-c]pyrrol-4-one (PubChem CID 70311244) has the molecular formula C19H31NO5 and a molecular weight of 353.46 g/mol. Its IUPAC name is (3aR,6R,6aS)-2-butoxy-6-[(S)-[(1S)-cyclohex-2-en-1-yl]-hydroxymethyl]-6-(hydroxymethyl)-6a-methyl-2,3,3a,5-tetrahydrofuro[2,3-c]pyrrol-4-one.
| Compound Name | (3aR,6R,6aS)-2-butoxy-6-[(S)-[(1S)-cyclohex-2-en-1-yl]-hydroxymethyl]-6-(hydroxymethyl)-6a-methyl-2,3,3a,5-tetrahydrofuro[2,3-c]pyrrol-4-one |
|---|---|
| PubChem CID | 70311244 |
| Molecular Formula | C19H31NO5 |
| Molecular Weight | 353.46 g/mol |
| Exact Mass | 353.22 |
| IUPAC Name | (3aR,6R,6aS)-2-butoxy-6-[(S)-[(1S)-cyclohex-2-en-1-yl]-hydroxymethyl]-6-(hydroxymethyl)-6a-methyl-2,3,3a,5-tetrahydrofuro[2,3-c]pyrrol-4-one |
| SMILES | CCCCOC1C[C@H]2C(=O)N[C@](CO)([C@@H](O)[C@@H]3C=CCCC3)[C@@]2(C)O1 |
| InChI | InChI=1S/C19H31NO5/c1-3-4-10-24-15-11-14-17(23)20-19(12-21,18(14,2)25-15)16(22)13-8-6-5-7-9-13/h6,8,13-16,21-22H,3-5,7,9-12H2,1-2H3,(H,20,23)/t13-,14+,15?,16+,18+,19-/m1/s1 |
| InChIKey | LQJVDZSQUZMNHZ-PBGWTAQISA-N |
| XLogP | 1.50 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.46 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|