C18H27N3S — CID 703114
8-(2-methylbutan-2-yl)-2-phenyl-1,2,4-triazaspiro[4.5]decane-3-thione (PubChem CID 703114) has the molecular formula C18H27N3S and a molecular weight of 317.50 g/mol. Its IUPAC name is 8-(2-methylbutan-2-yl)-2-phenyl-1,2,4-triazaspiro[4.5]decane-3-thione.
| Compound Name | 8-(2-methylbutan-2-yl)-2-phenyl-1,2,4-triazaspiro[4.5]decane-3-thione |
|---|---|
| PubChem CID | 703114 |
| Molecular Formula | C18H27N3S |
| Molecular Weight | 317.50 g/mol |
| Exact Mass | 317.19 |
| IUPAC Name | 8-(2-methylbutan-2-yl)-2-phenyl-1,2,4-triazaspiro[4.5]decane-3-thione |
| SMILES | CCC(C)(C)C1CCC2(CC1)NC(=S)N(c1ccccc1)N2 |
| InChI | InChI=1S/C18H27N3S/c1-4-17(2,3)14-10-12-18(13-11-14)19-16(22)21(20-18)15-8-6-5-7-9-15/h5-9,14,20H,4,10-13H2,1-3H3,(H,19,22) |
| InChIKey | GFWVAGCRUPZPOC-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.50 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|