C10H18O2 — CID 70311588
6,7-dimethyl-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-3-ol (PubChem CID 70311588) has the molecular formula C10H18O2 and a molecular weight of 170.25 g/mol. Its IUPAC name is 6,7-dimethyl-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-3-ol.
| Compound Name | 6,7-dimethyl-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-3-ol |
|---|---|
| PubChem CID | 70311588 |
| Molecular Formula | C10H18O2 |
| Molecular Weight | 170.25 g/mol |
| Exact Mass | 170.13 |
| IUPAC Name | 6,7-dimethyl-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-3-ol |
| SMILES | CC1CCC2C(O)COC2C1C |
| InChI | InChI=1S/C10H18O2/c1-6-3-4-8-9(11)5-12-10(8)7(6)2/h6-11H,3-5H2,1-2H3 |
| InChIKey | UEEOXSRPGCUNSU-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.25 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |