C13H16FNO2 — CID 70311629
(3R,6R,6aS)-4-benzyl-6-fluoro-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrol-3-ol (PubChem CID 70311629) has the molecular formula C13H16FNO2 and a molecular weight of 237.27 g/mol. Its IUPAC name is (3R,6R,6aS)-4-benzyl-6-fluoro-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrol-3-ol.
| Compound Name | (3R,6R,6aS)-4-benzyl-6-fluoro-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrol-3-ol |
|---|---|
| PubChem CID | 70311629 |
| Molecular Formula | C13H16FNO2 |
| Molecular Weight | 237.27 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | (3R,6R,6aS)-4-benzyl-6-fluoro-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrol-3-ol |
| SMILES | O[C@H]1CO[C@H]2C1N(Cc1ccccc1)C[C@H]2F |
| InChI | InChI=1S/C13H16FNO2/c14-10-7-15(6-9-4-2-1-3-5-9)12-11(16)8-17-13(10)12/h1-5,10-13,16H,6-8H2/t10-,11+,12?,13-/m1/s1 |
| InChIKey | SPIQCDFEVWTMLD-ZGVCCVRISA-N |
| XLogP | 0.97 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.27 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |