C17H21F3N4O — CID 70311649
5-[(1S,4R)-3-amino-4-(2,4,5-trifluorophenyl)cyclohexyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-d]imidazol-2-one (PubChem CID 70311649) has the molecular formula C17H21F3N4O and a molecular weight of 354.38 g/mol. Its IUPAC name is 5-[(1S,4R)-3-amino-4-(2,4,5-trifluorophenyl)cyclohexyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-d]imidazol-2-one.
| Compound Name | 5-[(1S,4R)-3-amino-4-(2,4,5-trifluorophenyl)cyclohexyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-d]imidazol-2-one |
|---|---|
| PubChem CID | 70311649 |
| Molecular Formula | C17H21F3N4O |
| Molecular Weight | 354.38 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | 5-[(1S,4R)-3-amino-4-(2,4,5-trifluorophenyl)cyclohexyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-d]imidazol-2-one |
| SMILES | NC1C[C@@H](N2CC3NC(=O)NC3C2)CC[C@@H]1c1cc(F)c(F)cc1F |
| InChI | InChI=1S/C17H21F3N4O/c18-11-5-13(20)12(19)4-10(11)9-2-1-8(3-14(9)21)24-6-15-16(7-24)23-17(25)22-15/h4-5,8-9,14-16H,1-3,6-7,21H2,(H2,22,23,25)/t8-,9+,14?,15?,16?/m0/s1 |
| InChIKey | ADSLSRXFTIYBRF-UUNGBIPWSA-N |
| XLogP | 1.43 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.38 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|