C26H33F2N3O5 — CID 70311702
[(3R,5S)-1-[2-(2,2-difluorohept-6-enylamino)acetyl]-5-methoxycarbonylpyrrolidin-3-yl] 4-ethenyl-1,3-dihydroisoindole-2-carboxylate (PubChem CID 70311702) has the molecular formula C26H33F2N3O5 and a molecular weight of 505.56 g/mol. Its IUPAC name is [(3R,5S)-1-[2-(2,2-difluorohept-6-enylamino)acetyl]-5-methoxycarbonylpyrrolidin-3-yl] 4-ethenyl-1,3-dihydroisoindole-2-carboxylate.
| Compound Name | [(3R,5S)-1-[2-(2,2-difluorohept-6-enylamino)acetyl]-5-methoxycarbonylpyrrolidin-3-yl] 4-ethenyl-1,3-dihydroisoindole-2-carboxylate |
|---|---|
| PubChem CID | 70311702 |
| Molecular Formula | C26H33F2N3O5 |
| Molecular Weight | 505.56 g/mol |
| Exact Mass | 505.24 |
| IUPAC Name | [(3R,5S)-1-[2-(2,2-difluorohept-6-enylamino)acetyl]-5-methoxycarbonylpyrrolidin-3-yl] 4-ethenyl-1,3-dihydroisoindole-2-carboxylate |
| SMILES | C=CCCCC(F)(F)CNCC(=O)N1C[C@H](OC(=O)N2Cc3cccc(C=C)c3C2)C[C@H]1C(=O)OC |
| InChI | InChI=1S/C26H33F2N3O5/c1-4-6-7-11-26(27,28)17-29-13-23(32)31-15-20(12-22(31)24(33)35-3)36-25(34)30-14-19-10-8-9-18(5-2)21(19)16-30/h4-5,8-10,20,22,29H,1-2,6-7,11-17H2,3H3/t20-,22+/m1/s1 |
| InChIKey | FIFBSMOWRGRKCE-IRLDBZIGSA-N |
| XLogP | 3.51 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.56 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|