C18H20F3N3O2 — CID 70311950
1-[2-methyl-1-(4-nitrophenyl)propan-2-yl]-3-(trifluoromethyl)-4,5,6,7-tetrahydroindazole (PubChem CID 70311950) has the molecular formula C18H20F3N3O2 and a molecular weight of 367.37 g/mol. Its IUPAC name is 1-[2-methyl-1-(4-nitrophenyl)propan-2-yl]-3-(trifluoromethyl)-4,5,6,7-tetrahydroindazole.
| Compound Name | 1-[2-methyl-1-(4-nitrophenyl)propan-2-yl]-3-(trifluoromethyl)-4,5,6,7-tetrahydroindazole |
|---|---|
| PubChem CID | 70311950 |
| Molecular Formula | C18H20F3N3O2 |
| Molecular Weight | 367.37 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | 1-[2-methyl-1-(4-nitrophenyl)propan-2-yl]-3-(trifluoromethyl)-4,5,6,7-tetrahydroindazole |
| SMILES | CC(C)(Cc1ccc([N+](=O)[O-])cc1)n1nc(C(F)(F)F)c2c1CCCC2 |
| InChI | InChI=1S/C18H20F3N3O2/c1-17(2,11-12-7-9-13(10-8-12)24(25)26)23-15-6-4-3-5-14(15)16(22-23)18(19,20)21/h7-10H,3-6,11H2,1-2H3 |
| InChIKey | CNTYLLFUWNKFMQ-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 60.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.37 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|