C17H20N4O2 — CID 70312132
4,12-dimethyl-8-phenyl-2,4,6,12-tetrazatricyclo[7.4.0.02,6]tridec-8-ene-3,5-dione (PubChem CID 70312132) has the molecular formula C17H20N4O2 and a molecular weight of 312.37 g/mol. Its IUPAC name is 4,12-dimethyl-8-phenyl-2,4,6,12-tetrazatricyclo[7.4.0.02,6]tridec-8-ene-3,5-dione.
| Compound Name | 4,12-dimethyl-8-phenyl-2,4,6,12-tetrazatricyclo[7.4.0.02,6]tridec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 70312132 |
| Molecular Formula | C17H20N4O2 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | 4,12-dimethyl-8-phenyl-2,4,6,12-tetrazatricyclo[7.4.0.02,6]tridec-8-ene-3,5-dione |
| SMILES | CN1CCC2=C(c3ccccc3)Cn3c(=O)n(C)c(=O)n3C2C1 |
| InChI | InChI=1S/C17H20N4O2/c1-18-9-8-13-14(12-6-4-3-5-7-12)10-20-16(22)19(2)17(23)21(20)15(13)11-18/h3-7,15H,8-11H2,1-2H3 |
| InChIKey | GXBYPKKHLQALHG-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 52.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |