About 6-(2,4-dichlorophenyl)-7-ethyl-3-morpholin-4-ylimidazo[1,2-a]pyridin-8-amine
6-(2,4-dichlorophenyl)-7-ethyl-3-morpholin-4-ylimidazo[1,2-a]pyridin-8-amine (PubChem CID 70312232) has the molecular formula C19H20Cl2N4O
and a molecular weight of 391.30 g/mol. Its IUPAC name is 6-(2,4-dichlorophenyl)-7-ethyl-3-morpholin-4-ylimidazo[1,2-a]pyridin-8-amine.
Molecular Properties
| Compound Name | 6-(2,4-dichlorophenyl)-7-ethyl-3-morpholin-4-ylimidazo[1,2-a]pyridin-8-amine |
| PubChem CID | 70312232 |
| Molecular Formula | C19H20Cl2N4O |
| Molecular Weight | 391.30 g/mol |
| Exact Mass | 390.10 |
| IUPAC Name | 6-(2,4-dichlorophenyl)-7-ethyl-3-morpholin-4-ylimidazo[1,2-a]pyridin-8-amine |
| SMILES | CCc1c(-c2ccc(Cl)cc2Cl)cn2c(N3CCOCC3)cnc2c1N |
| InChI | InChI=1S/C19H20Cl2N4O/c1-2-13-15(14-4-3-12(20)9-16(14)21)11-25-17(10-23-19(25)18(13)22)24-5-7-26-8-6-24/h3-4,9-11H,2,5-8,22H2,1H3 |
| InChIKey | QNISCGWDHNEEND-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 55.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 391.30 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-(2,4-dichlorophenyl)-7-ethyl-3-morpholin-4-ylimidazo[1,2-a]pyridin-8-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2,4-dichlorophenyl)-7-ethyl-3-morpholin-4-ylimidazo[1,2-a]pyridin-8-amine?
The IUPAC name of 6-(2,4-dichlorophenyl)-7-ethyl-3-morpholin-4-ylimidazo[1,2-a]pyridin-8-amine (CID 70312232) is 6-(2,4-dichlorophenyl)-7-ethyl-3-morpholin-4-ylimidazo[1,2-a]pyridin-8-amine.
What is the SMILES notation for 6-(2,4-dichlorophenyl)-7-ethyl-3-morpholin-4-ylimidazo[1,2-a]pyridin-8-amine?
The canonical SMILES for 6-(2,4-dichlorophenyl)-7-ethyl-3-morpholin-4-ylimidazo[1,2-a]pyridin-8-amine is CCc1c(-c2ccc(Cl)cc2Cl)cn2c(N3CCOCC3)cnc2c1N.
What is the InChIKey of 6-(2,4-dichlorophenyl)-7-ethyl-3-morpholin-4-ylimidazo[1,2-a]pyridin-8-amine?
The InChIKey is QNISCGWDHNEEND-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20Cl2N4O/c1-2-13-15(14-4-3-12(20)9-16(14)21)11-25-17(10-23-19(25)18(13)22)24-5-7-26-8-6-24/h3-4,9-11H,2,5-8,22H2,1H3.
What are the key properties of 6-(2,4-dichlorophenyl)-7-ethyl-3-morpholin-4-ylimidazo[1,2-a]pyridin-8-amine?
6-(2,4-dichlorophenyl)-7-ethyl-3-morpholin-4-ylimidazo[1,2-a]pyridin-8-amine has a molecular weight of 391.30 g/mol, XLogP of 4.29, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2,4-dichlorophenyl)-7-ethyl-3-morpholin-4-ylimidazo[1,2-a]pyridin-8-amine is sourced from PubChem (CID 70312232), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).