C12H8N4O2 — CID 70312486
5-(2-pyrazolo[1,5-a]pyridin-3-ylethynyl)imidazolidine-2,4-dione (PubChem CID 70312486) has the molecular formula C12H8N4O2 and a molecular weight of 240.22 g/mol. Its IUPAC name is 5-(2-pyrazolo[1,5-a]pyridin-3-ylethynyl)imidazolidine-2,4-dione.
| Compound Name | 5-(2-pyrazolo[1,5-a]pyridin-3-ylethynyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 70312486 |
| Molecular Formula | C12H8N4O2 |
| Molecular Weight | 240.22 g/mol |
| Exact Mass | 240.06 |
| IUPAC Name | 5-(2-pyrazolo[1,5-a]pyridin-3-ylethynyl)imidazolidine-2,4-dione |
| SMILES | O=C1NC(=O)C(C#Cc2cnn3ccccc23)N1 |
| InChI | InChI=1S/C12H8N4O2/c17-11-9(14-12(18)15-11)5-4-8-7-13-16-6-2-1-3-10(8)16/h1-3,6-7,9H,(H2,14,15,17,18) |
| InChIKey | QVGNRBPHGWKRCR-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 75.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.22 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|