C27H28IN2O6P — CID 70313207
[7-iodo-1-[2-methyl-4-[(2-methylbenzoyl)amino]benzoyl]-2,3,4,5-tetrahydro-1-benzazepin-5-yl] methyl hydrogen phosphate (PubChem CID 70313207) has the molecular formula C27H28IN2O6P and a molecular weight of 634.41 g/mol. Its IUPAC name is [7-iodo-1-[2-methyl-4-[(2-methylbenzoyl)amino]benzoyl]-2,3,4,5-tetrahydro-1-benzazepin-5-yl] methyl hydrogen phosphate.
| Compound Name | [7-iodo-1-[2-methyl-4-[(2-methylbenzoyl)amino]benzoyl]-2,3,4,5-tetrahydro-1-benzazepin-5-yl] methyl hydrogen phosphate |
|---|---|
| PubChem CID | 70313207 |
| Molecular Formula | C27H28IN2O6P |
| Molecular Weight | 634.41 g/mol |
| Exact Mass | 634.07 |
| IUPAC Name | [7-iodo-1-[2-methyl-4-[(2-methylbenzoyl)amino]benzoyl]-2,3,4,5-tetrahydro-1-benzazepin-5-yl] methyl hydrogen phosphate |
| SMILES | COP(=O)(O)OC1CCCN(C(=O)c2ccc(NC(=O)c3ccccc3C)cc2C)c2ccc(I)cc21 |
| InChI | InChI=1S/C27H28IN2O6P/c1-17-7-4-5-8-21(17)26(31)29-20-11-12-22(18(2)15-20)27(32)30-14-6-9-25(36-37(33,34)35-3)23-16-19(28)10-13-24(23)30/h4-5,7-8,10-13,15-16,25H,6,9,14H2,1-3H3,(H,29,31)(H,33,34) |
| InChIKey | NYIKPIJBNXKHLP-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.41 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|