About 7-(2-methylsulfanylpyrimidin-4-yl)-5H-imidazo[1,2-b]pyrazole
7-(2-methylsulfanylpyrimidin-4-yl)-5H-imidazo[1,2-b]pyrazole (PubChem CID 70313324) has the molecular formula C10H9N5S
and a molecular weight of 231.28 g/mol. Its IUPAC name is 7-(2-methylsulfanylpyrimidin-4-yl)-5H-imidazo[1,2-b]pyrazole.
Molecular Properties
| Compound Name | 7-(2-methylsulfanylpyrimidin-4-yl)-5H-imidazo[1,2-b]pyrazole |
| PubChem CID | 70313324 |
| Molecular Formula | C10H9N5S |
| Molecular Weight | 231.28 g/mol |
| Exact Mass | 231.06 |
| IUPAC Name | 7-(2-methylsulfanylpyrimidin-4-yl)-5H-imidazo[1,2-b]pyrazole |
| SMILES | CSc1nccc(-c2c[nH]n3ccnc23)n1 |
| InChI | InChI=1S/C10H9N5S/c1-16-10-12-3-2-8(14-10)7-6-13-15-5-4-11-9(7)15/h2-6,13H,1H3 |
| InChIKey | RSNSAGYHFMIUDB-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 58.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.28 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 7-(2-methylsulfanylpyrimidin-4-yl)-5H-imidazo[1,2-b]pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(2-methylsulfanylpyrimidin-4-yl)-5H-imidazo[1,2-b]pyrazole?
The IUPAC name of 7-(2-methylsulfanylpyrimidin-4-yl)-5H-imidazo[1,2-b]pyrazole (CID 70313324) is 7-(2-methylsulfanylpyrimidin-4-yl)-5H-imidazo[1,2-b]pyrazole.
What is the SMILES notation for 7-(2-methylsulfanylpyrimidin-4-yl)-5H-imidazo[1,2-b]pyrazole?
The canonical SMILES for 7-(2-methylsulfanylpyrimidin-4-yl)-5H-imidazo[1,2-b]pyrazole is CSc1nccc(-c2c[nH]n3ccnc23)n1.
What is the InChIKey of 7-(2-methylsulfanylpyrimidin-4-yl)-5H-imidazo[1,2-b]pyrazole?
The InChIKey is RSNSAGYHFMIUDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N5S/c1-16-10-12-3-2-8(14-10)7-6-13-15-5-4-11-9(7)15/h2-6,13H,1H3.
What are the key properties of 7-(2-methylsulfanylpyrimidin-4-yl)-5H-imidazo[1,2-b]pyrazole?
7-(2-methylsulfanylpyrimidin-4-yl)-5H-imidazo[1,2-b]pyrazole has a molecular weight of 231.28 g/mol, XLogP of 1.84, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(2-methylsulfanylpyrimidin-4-yl)-5H-imidazo[1,2-b]pyrazole is sourced from PubChem (CID 70313324), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).