C9H17NO — CID 70313372
(4aR,8aR)-7-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-benzo[b][1,4]oxazine (PubChem CID 70313372) has the molecular formula C9H17NO and a molecular weight of 155.24 g/mol. Its IUPAC name is (4aR,8aR)-7-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-benzo[b][1,4]oxazine.
| Compound Name | (4aR,8aR)-7-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-benzo[b][1,4]oxazine |
|---|---|
| PubChem CID | 70313372 |
| Molecular Formula | C9H17NO |
| Molecular Weight | 155.24 g/mol |
| Exact Mass | 155.13 |
| IUPAC Name | (4aR,8aR)-7-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-benzo[b][1,4]oxazine |
| SMILES | CC1CC[C@H]2NCCO[C@@H]2C1 |
| InChI | InChI=1S/C9H17NO/c1-7-2-3-8-9(6-7)11-5-4-10-8/h7-10H,2-6H2,1H3/t7?,8-,9-/m1/s1 |
| InChIKey | MVHCIRMDZHBDFO-CFCGPWAMSA-N |
| XLogP | 1.16 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.24 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |