About 1-[(5R)-2-ethyl-5-methoxycyclohexa-1,3-dien-1-yl]ethanone
1-[(5R)-2-ethyl-5-methoxycyclohexa-1,3-dien-1-yl]ethanone (PubChem CID 70313568) has the molecular formula C11H16O2
and a molecular weight of 180.25 g/mol. Its IUPAC name is 1-[(5R)-2-ethyl-5-methoxycyclohexa-1,3-dien-1-yl]ethanone.
Molecular Properties
| Compound Name | 1-[(5R)-2-ethyl-5-methoxycyclohexa-1,3-dien-1-yl]ethanone |
| PubChem CID | 70313568 |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | 1-[(5R)-2-ethyl-5-methoxycyclohexa-1,3-dien-1-yl]ethanone |
| SMILES | CCC1=C(C(C)=O)C[C@@H](OC)C=C1 |
| InChI | InChI=1S/C11H16O2/c1-4-9-5-6-10(13-3)7-11(9)8(2)12/h5-6,10H,4,7H2,1-3H3/t10-/m0/s1 |
| InChIKey | RONIPPRXMUTZIC-JTQLQIEISA-N |
| XLogP | 2.26 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[(5R)-2-ethyl-5-methoxycyclohexa-1,3-dien-1-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(5R)-2-ethyl-5-methoxycyclohexa-1,3-dien-1-yl]ethanone?
The IUPAC name of 1-[(5R)-2-ethyl-5-methoxycyclohexa-1,3-dien-1-yl]ethanone (CID 70313568) is 1-[(5R)-2-ethyl-5-methoxycyclohexa-1,3-dien-1-yl]ethanone.
What is the SMILES notation for 1-[(5R)-2-ethyl-5-methoxycyclohexa-1,3-dien-1-yl]ethanone?
The canonical SMILES for 1-[(5R)-2-ethyl-5-methoxycyclohexa-1,3-dien-1-yl]ethanone is CCC1=C(C(C)=O)C[C@@H](OC)C=C1.
What is the InChIKey of 1-[(5R)-2-ethyl-5-methoxycyclohexa-1,3-dien-1-yl]ethanone?
The InChIKey is RONIPPRXMUTZIC-JTQLQIEISA-N. The full InChI is InChI=1S/C11H16O2/c1-4-9-5-6-10(13-3)7-11(9)8(2)12/h5-6,10H,4,7H2,1-3H3/t10-/m0/s1.
What are the key properties of 1-[(5R)-2-ethyl-5-methoxycyclohexa-1,3-dien-1-yl]ethanone?
1-[(5R)-2-ethyl-5-methoxycyclohexa-1,3-dien-1-yl]ethanone has a molecular weight of 180.25 g/mol, XLogP of 2.26, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(5R)-2-ethyl-5-methoxycyclohexa-1,3-dien-1-yl]ethanone is sourced from PubChem (CID 70313568), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).