About 1,3-dimethyl-1,3-diazepan-2-imine
1,3-dimethyl-1,3-diazepan-2-imine (PubChem CID 70313790) has the molecular formula C7H15N3
and a molecular weight of 141.22 g/mol. Its IUPAC name is 1,3-dimethyl-1,3-diazepan-2-imine.
Molecular Properties
| Compound Name | 1,3-dimethyl-1,3-diazepan-2-imine |
| PubChem CID | 70313790 |
| Molecular Formula | C7H15N3 |
| Molecular Weight | 141.22 g/mol |
| Exact Mass | 141.13 |
| IUPAC Name | 1,3-dimethyl-1,3-diazepan-2-imine |
| SMILES | [H]N=C1N(C)CCCCN1C |
| InChI | InChI=1S/C7H15N3/c1-9-5-3-4-6-10(2)7(9)8/h8H,3-6H2,1-2H3 |
| InChIKey | DPWDZBGETQSFRI-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 30.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.22 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 1,3-dimethyl-1,3-diazepan-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dimethyl-1,3-diazepan-2-imine?
The IUPAC name of 1,3-dimethyl-1,3-diazepan-2-imine (CID 70313790) is 1,3-dimethyl-1,3-diazepan-2-imine.
What is the SMILES notation for 1,3-dimethyl-1,3-diazepan-2-imine?
The canonical SMILES for 1,3-dimethyl-1,3-diazepan-2-imine is [H]N=C1N(C)CCCCN1C.
What is the InChIKey of 1,3-dimethyl-1,3-diazepan-2-imine?
The InChIKey is DPWDZBGETQSFRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15N3/c1-9-5-3-4-6-10(2)7(9)8/h8H,3-6H2,1-2H3.
What are the key properties of 1,3-dimethyl-1,3-diazepan-2-imine?
1,3-dimethyl-1,3-diazepan-2-imine has a molecular weight of 141.22 g/mol, XLogP of 0.58, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dimethyl-1,3-diazepan-2-imine is sourced from PubChem (CID 70313790), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).