C22H14F5N5O2 — CID 70313887
2,5-difluoro-N-[5-[5-(1-methoxyethenyl)-2-(trifluoromethyl)benzimidazol-1-yl]pyrazin-2-yl]benzamide (PubChem CID 70313887) has the molecular formula C22H14F5N5O2 and a molecular weight of 475.38 g/mol. Its IUPAC name is 2,5-difluoro-N-[5-[5-(1-methoxyethenyl)-2-(trifluoromethyl)benzimidazol-1-yl]pyrazin-2-yl]benzamide.
| Compound Name | 2,5-difluoro-N-[5-[5-(1-methoxyethenyl)-2-(trifluoromethyl)benzimidazol-1-yl]pyrazin-2-yl]benzamide |
|---|---|
| PubChem CID | 70313887 |
| Molecular Formula | C22H14F5N5O2 |
| Molecular Weight | 475.38 g/mol |
| Exact Mass | 475.11 |
| IUPAC Name | 2,5-difluoro-N-[5-[5-(1-methoxyethenyl)-2-(trifluoromethyl)benzimidazol-1-yl]pyrazin-2-yl]benzamide |
| SMILES | C=C(OC)c1ccc2c(c1)nc(C(F)(F)F)n2-c1cnc(NC(=O)c2cc(F)ccc2F)cn1 |
| InChI | InChI=1S/C22H14F5N5O2/c1-11(34-2)12-3-6-17-16(7-12)30-21(22(25,26)27)32(17)19-10-28-18(9-29-19)31-20(33)14-8-13(23)4-5-15(14)24/h3-10H,1H2,2H3,(H,28,31,33) |
| InChIKey | XUBDDWOSVNKHHI-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.38 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|