C24H37NO2 — CID 70313955
(17S)-3-ethoxy-13-ethyl-10-methyl-17-(methylaminomethyl)-1,2,7,8,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-ol (PubChem CID 70313955) has the molecular formula C24H37NO2 and a molecular weight of 371.57 g/mol. Its IUPAC name is (17S)-3-ethoxy-13-ethyl-10-methyl-17-(methylaminomethyl)-1,2,7,8,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-ol.
| Compound Name | (17S)-3-ethoxy-13-ethyl-10-methyl-17-(methylaminomethyl)-1,2,7,8,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-ol |
|---|---|
| PubChem CID | 70313955 |
| Molecular Formula | C24H37NO2 |
| Molecular Weight | 371.57 g/mol |
| Exact Mass | 371.28 |
| IUPAC Name | (17S)-3-ethoxy-13-ethyl-10-methyl-17-(methylaminomethyl)-1,2,7,8,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-ol |
| SMILES | CCOC1=CC2=CCC3C(=CCC4(CC)C3CC[C@@]4(O)CNC)C2(C)CC1 |
| InChI | InChI=1S/C24H37NO2/c1-5-23-13-10-20-19(21(23)11-14-24(23,26)16-25-4)8-7-17-15-18(27-6-2)9-12-22(17,20)3/h7,10,15,19,21,25-26H,5-6,8-9,11-14,16H2,1-4H3/t19?,21?,22?,23?,24-/m1/s1 |
| InChIKey | JHNLXRBAFZXLBT-KPEBZCTASA-N |
| XLogP | 4.74 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.57 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|