C35H38N2O2 — CID 70314430
(4-ethoxy-2,6-diethylphenyl)-(1-trityl-4,5-dihydroimidazol-4-yl)methanol (PubChem CID 70314430) has the molecular formula C35H38N2O2 and a molecular weight of 518.70 g/mol. Its IUPAC name is (4-ethoxy-2,6-diethylphenyl)-(1-trityl-4,5-dihydroimidazol-4-yl)methanol.
| Compound Name | (4-ethoxy-2,6-diethylphenyl)-(1-trityl-4,5-dihydroimidazol-4-yl)methanol |
|---|---|
| PubChem CID | 70314430 |
| Molecular Formula | C35H38N2O2 |
| Molecular Weight | 518.70 g/mol |
| Exact Mass | 518.29 |
| IUPAC Name | (4-ethoxy-2,6-diethylphenyl)-(1-trityl-4,5-dihydroimidazol-4-yl)methanol |
| SMILES | CCOc1cc(CC)c(C(O)C2CN(C(c3ccccc3)(c3ccccc3)c3ccccc3)C=N2)c(CC)c1 |
| InChI | InChI=1S/C35H38N2O2/c1-4-26-22-31(39-6-3)23-27(5-2)33(26)34(38)32-24-37(25-36-32)35(28-16-10-7-11-17-28,29-18-12-8-13-19-29)30-20-14-9-15-21-30/h7-23,25,32,34,38H,4-6,24H2,1-3H3 |
| InChIKey | UMJIALCEYBKAQS-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 45.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.70 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|