C20H19ClF2O4S — CID 70314677
(6aS,7S,8S,10aS)-10a-(4-chlorophenyl)sulfonyl-1,7-difluoro-4-methyl-6,6a,7,8,9,10-hexahydrobenzo[c]chromen-8-ol (PubChem CID 70314677) has the molecular formula C20H19ClF2O4S and a molecular weight of 428.88 g/mol. Its IUPAC name is (6aS,7S,8S,10aS)-10a-(4-chlorophenyl)sulfonyl-1,7-difluoro-4-methyl-6,6a,7,8,9,10-hexahydrobenzo[c]chromen-8-ol.
| Compound Name | (6aS,7S,8S,10aS)-10a-(4-chlorophenyl)sulfonyl-1,7-difluoro-4-methyl-6,6a,7,8,9,10-hexahydrobenzo[c]chromen-8-ol |
|---|---|
| PubChem CID | 70314677 |
| Molecular Formula | C20H19ClF2O4S |
| Molecular Weight | 428.88 g/mol |
| Exact Mass | 428.07 |
| IUPAC Name | (6aS,7S,8S,10aS)-10a-(4-chlorophenyl)sulfonyl-1,7-difluoro-4-methyl-6,6a,7,8,9,10-hexahydrobenzo[c]chromen-8-ol |
| SMILES | Cc1ccc(F)c2c1OC[C@H]1[C@H](F)[C@@H](O)CC[C@@]21S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H19ClF2O4S/c1-11-2-7-15(22)17-19(11)27-10-14-18(23)16(24)8-9-20(14,17)28(25,26)13-5-3-12(21)4-6-13/h2-7,14,16,18,24H,8-10H2,1H3/t14-,16-,18-,20-/m0/s1 |
| InChIKey | JDDDSSQZUGQKGG-QQDKQVRDSA-N |
| XLogP | 3.96 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.88 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |