About 1-Methylguanine
1-Methylguanine (PubChem CID 70315) has the molecular formula C6H7N5O
and a molecular weight of 165.15 g/mol. Its IUPAC name is 2-amino-1-methyl-7H-purin-6-one.
Molecular Properties
| Compound Name | 1-Methylguanine |
| PubChem CID | 70315 |
| Molecular Formula | C6H7N5O |
| Molecular Weight | 165.15 g/mol |
| Exact Mass | 165.07 |
| IUPAC Name | 2-amino-1-methyl-7H-purin-6-one |
| SMILES | CN1C(=O)C2=C(N=CN2)N=C1N |
| InChI | InChI=1S/C6H7N5O/c1-11-5(12)3-4(9-2-8-3)10-6(11)7/h2H,1H3,(H2,7,10)(H,8,9) |
| InChIKey | RFLVMTUMFYRZCB-UHFFFAOYSA-N |
| XLogP | -0.90 |
| TPSA | 87.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | 250 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.15 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-Methylguanine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-Methylguanine?
The IUPAC name of 1-Methylguanine (CID 70315) is 2-amino-1-methyl-7H-purin-6-one.
What is the SMILES notation for 1-Methylguanine?
The canonical SMILES for 1-Methylguanine is CN1C(=O)C2=C(N=CN2)N=C1N.
What is the InChIKey of 1-Methylguanine?
The InChIKey is RFLVMTUMFYRZCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7N5O/c1-11-5(12)3-4(9-2-8-3)10-6(11)7/h2H,1H3,(H2,7,10)(H,8,9).
What are the key properties of 1-Methylguanine?
1-Methylguanine has a molecular weight of 165.15 g/mol, XLogP of -0.90, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-Methylguanine is sourced from PubChem (CID 70315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).