C22H21ClF2O5S — CID 70315383
4-[(4S,10bS)-10b-(4-chlorophenyl)sulfonyl-7,10-difluoro-2,4,4a,5-tetrahydro-1H-pyrano[3,4-c]chromen-4-yl]butan-2-one (PubChem CID 70315383) has the molecular formula C22H21ClF2O5S and a molecular weight of 470.92 g/mol. Its IUPAC name is 4-[(4S,10bS)-10b-(4-chlorophenyl)sulfonyl-7,10-difluoro-2,4,4a,5-tetrahydro-1H-pyrano[3,4-c]chromen-4-yl]butan-2-one.
| Compound Name | 4-[(4S,10bS)-10b-(4-chlorophenyl)sulfonyl-7,10-difluoro-2,4,4a,5-tetrahydro-1H-pyrano[3,4-c]chromen-4-yl]butan-2-one |
|---|---|
| PubChem CID | 70315383 |
| Molecular Formula | C22H21ClF2O5S |
| Molecular Weight | 470.92 g/mol |
| Exact Mass | 470.08 |
| IUPAC Name | 4-[(4S,10bS)-10b-(4-chlorophenyl)sulfonyl-7,10-difluoro-2,4,4a,5-tetrahydro-1H-pyrano[3,4-c]chromen-4-yl]butan-2-one |
| SMILES | CC(=O)CC[C@@H]1OCC[C@@]2(S(=O)(=O)c3ccc(Cl)cc3)c3c(F)ccc(F)c3OCC12 |
| InChI | InChI=1S/C22H21ClF2O5S/c1-13(26)2-9-19-16-12-30-21-18(25)8-7-17(24)20(21)22(16,10-11-29-19)31(27,28)15-5-3-14(23)4-6-15/h3-8,16,19H,2,9-12H2,1H3/t16?,19-,22-/m0/s1 |
| InChIKey | JZYDCBCHRBYCPO-GNAUSZLLSA-N |
| XLogP | 4.45 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.92 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |