C24H41N3O4 — CID 70315582
(1R)-4-[(2S)-2-amino-3,3-dimethylbutanoyl]-N-[1,2-dioxo-1-(prop-2-enylamino)heptan-3-yl]cycloheptane-1-carboxamide (PubChem CID 70315582) has the molecular formula C24H41N3O4 and a molecular weight of 435.61 g/mol. Its IUPAC name is (1R)-4-[(2S)-2-amino-3,3-dimethylbutanoyl]-N-[1,2-dioxo-1-(prop-2-enylamino)heptan-3-yl]cycloheptane-1-carboxamide.
| Compound Name | (1R)-4-[(2S)-2-amino-3,3-dimethylbutanoyl]-N-[1,2-dioxo-1-(prop-2-enylamino)heptan-3-yl]cycloheptane-1-carboxamide |
|---|---|
| PubChem CID | 70315582 |
| Molecular Formula | C24H41N3O4 |
| Molecular Weight | 435.61 g/mol |
| Exact Mass | 435.31 |
| IUPAC Name | (1R)-4-[(2S)-2-amino-3,3-dimethylbutanoyl]-N-[1,2-dioxo-1-(prop-2-enylamino)heptan-3-yl]cycloheptane-1-carboxamide |
| SMILES | C=CCNC(=O)C(=O)C(CCCC)NC(=O)[C@@H]1CCCC(C(=O)[C@@H](N)C(C)(C)C)CC1 |
| InChI | InChI=1S/C24H41N3O4/c1-6-8-12-18(20(29)23(31)26-15-7-2)27-22(30)17-11-9-10-16(13-14-17)19(28)21(25)24(3,4)5/h7,16-18,21H,2,6,8-15,25H2,1,3-5H3,(H,26,31)(H,27,30)/t16?,17-,18?,21-/m1/s1 |
| InChIKey | RZSXCYGRQICHPA-ZTNRTKLDSA-N |
| XLogP | 2.67 |
| TPSA | 118.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.61 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|