C15H25N3O3S — CID 7031573
5-[3-[(3S)-heptan-3-yl]oxypropyliminomethyl]-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 7031573) has the molecular formula C15H25N3O3S and a molecular weight of 327.45 g/mol. Its IUPAC name is 5-[3-[(3S)-heptan-3-yl]oxypropyliminomethyl]-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | 5-[3-[(3S)-heptan-3-yl]oxypropyliminomethyl]-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 7031573 |
| Molecular Formula | C15H25N3O3S |
| Molecular Weight | 327.45 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | 5-[3-[(3S)-heptan-3-yl]oxypropyliminomethyl]-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | CCCC[C@H](CC)OCCC/N=C/C1C(=O)NC(=S)NC1=O |
| InChI | InChI=1S/C15H25N3O3S/c1-3-5-7-11(4-2)21-9-6-8-16-10-12-13(19)17-15(22)18-14(12)20/h10-12H,3-9H2,1-2H3,(H2,17,18,19,20,22)/b16-10+/t11-/m0/s1 |
| InChIKey | IOYOOGANQINPKL-YAFRSCOQSA-N |
| XLogP | 1.58 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.45 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|